C28H32N2O3 — CID 43954206
ethyl 4-[benzyl(2-phenylethyl)carbamoyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxylate (PubChem CID 43954206) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is ethyl 4-[benzyl(2-phenylethyl)carbamoyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-[benzyl(2-phenylethyl)carbamoyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 43954206 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | ethyl 4-[benzyl(2-phenylethyl)carbamoyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxylate |
| SMILES | C=CCn1c(C)c(C(=O)N(CCc2ccccc2)Cc2ccccc2)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C28H32N2O3/c1-5-18-30-22(4)25(21(3)26(30)28(32)33-6-2)27(31)29(20-24-15-11-8-12-16-24)19-17-23-13-9-7-10-14-23/h5,7-16H,1,6,17-20H2,2-4H3 |
| InChIKey | FAAQCRAPAYSPSA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|