C23H23N3O3S — CID 43982794
(Z)-3-(1,3-benzodioxol-5-yl)-1-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 43982794) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-1-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-1-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 43982794 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-1-[4-(4,5-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1ccc2sc(N3CCN(C(=O)/C=C\c4ccc5c(c4)OCO5)CC3)nc2c1C |
| InChI | InChI=1S/C23H23N3O3S/c1-15-3-7-20-22(16(15)2)24-23(30-20)26-11-9-25(10-12-26)21(27)8-5-17-4-6-18-19(13-17)29-14-28-18/h3-8,13H,9-12,14H2,1-2H3/b8-5- |
| InChIKey | ZHOQCNMJYCOLPJ-YVMONPNESA-N |
| XLogP | 4.00 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|