C19H24N2O4 — CID 43985264
N-(oxolan-2-ylmethyl)-2-(1-oxo-2-propylisoquinolin-5-yl)oxyacetamide (PubChem CID 43985264) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-(1-oxo-2-propylisoquinolin-5-yl)oxyacetamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-(1-oxo-2-propylisoquinolin-5-yl)oxyacetamide |
|---|---|
| PubChem CID | 43985264 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-(1-oxo-2-propylisoquinolin-5-yl)oxyacetamide |
| SMILES | CCCn1ccc2c(OCC(=O)NCC3CCCO3)cccc2c1=O |
| InChI | InChI=1S/C19H24N2O4/c1-2-9-21-10-8-15-16(19(21)23)6-3-7-17(15)25-13-18(22)20-12-14-5-4-11-24-14/h3,6-8,10,14H,2,4-5,9,11-13H2,1H3,(H,20,22) |
| InChIKey | UNMLYZSGHCJAMC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |