C18H22N2O4 — CID 7293149
2-(2-ethyl-1-oxoisoquinolin-5-yl)oxy-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 7293149) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-(2-ethyl-1-oxoisoquinolin-5-yl)oxy-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-(2-ethyl-1-oxoisoquinolin-5-yl)oxy-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 7293149 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-(2-ethyl-1-oxoisoquinolin-5-yl)oxy-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | CCn1ccc2c(OCC(=O)NC[C@H]3CCCO3)cccc2c1=O |
| InChI | InChI=1S/C18H22N2O4/c1-2-20-9-8-14-15(18(20)22)6-3-7-16(14)24-12-17(21)19-11-13-5-4-10-23-13/h3,6-9,13H,2,4-5,10-12H2,1H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | POMRFWQBWPAVHC-CYBMUJFWSA-N |
| XLogP | 1.70 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |