About 5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix)
5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix) (PubChem CID 44230732) has the molecular formula C19H20N2
and a molecular weight of 276.40 g/mol. Its IUPAC name is 5-(3-benzylpyrrolidin-3-yl)-1H-indole.
Molecular Properties
| Compound Name | 5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix) |
| PubChem CID | 44230732 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 5-(3-benzylpyrrolidin-3-yl)-1H-indole |
| SMILES | C1CNCC1(CC2=CC=CC=C2)C3=CC4=C(C=C3)NC=C4 |
| InChI | InChI=1S/C19H20N2/c1-2-4-15(5-3-1)13-19(9-11-20-14-19)17-6-7-18-16(12-17)8-10-21-18/h1-8,10,12,20-21H,9,11,13-14H2 |
| InChIKey | UZKWACFLBGIUSH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 27.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | 349 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix)?
The IUPAC name of 5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix) (CID 44230732) is 5-(3-benzylpyrrolidin-3-yl)-1H-indole.
What is the SMILES notation for 5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix)?
The canonical SMILES for 5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix) is C1CNCC1(CC2=CC=CC=C2)C3=CC4=C(C=C3)NC=C4.
What is the InChIKey of 5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix)?
The InChIKey is UZKWACFLBGIUSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2/c1-2-4-15(5-3-1)13-19(9-11-20-14-19)17-6-7-18-16(12-17)8-10-21-18/h1-8,10,12,20-21H,9,11,13-14H2.
What are the key properties of 5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix)?
5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix) has a molecular weight of 276.40 g/mol, XLogP of 3.80, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-Benzylpyrrolidin-3-YL)-1H-indole (structural mix) is sourced from PubChem (CID 44230732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).