C18H30O5 — CID 44357178
2-[5-[(E)-4,8-dimethyl-5-oxonon-6-enyl]-5-methyl-1,4-dioxan-2-yl]acetic acid (PubChem CID 44357178) has the molecular formula C18H30O5 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[5-[(E)-4,8-dimethyl-5-oxonon-6-enyl]-5-methyl-1,4-dioxan-2-yl]acetic acid.
| Compound Name | 2-[5-[(E)-4,8-dimethyl-5-oxonon-6-enyl]-5-methyl-1,4-dioxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 44357178 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2-[5-[(E)-4,8-dimethyl-5-oxonon-6-enyl]-5-methyl-1,4-dioxan-2-yl]acetic acid |
| SMILES | CC(C)/C=C/C(=O)C(C)CCCC1(COC(CO1)CC(=O)O)C |
| InChI | InChI=1S/C18H30O5/c1-13(2)7-8-16(19)14(3)6-5-9-18(4)12-22-15(11-23-18)10-17(20)21/h7-8,13-15H,5-6,9-12H2,1-4H3,(H,20,21)/b8-7+ |
| InChIKey | FZBYJYYCJTZORP-BQYQJAHWSA-N |
| XLogP | 2.40 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | 429 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|