C10H18N2O — CID 44364338
2-Amino-1-(2,5-dihydro-pyrrol-1-yl)-3-methyl-pentan-1-one (PubChem CID 44364338) has the molecular formula C10H18N2O and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-amino-1-(2,5-dihydropyrrol-1-yl)-3-methylpentan-1-one.
| Compound Name | 2-Amino-1-(2,5-dihydro-pyrrol-1-yl)-3-methyl-pentan-1-one |
|---|---|
| PubChem CID | 44364338 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 2-amino-1-(2,5-dihydropyrrol-1-yl)-3-methylpentan-1-one |
| SMILES | CCC(C)C(C(=O)N1CC=CC1)N |
| InChI | InChI=1S/C10H18N2O/c1-3-8(2)9(11)10(13)12-6-4-5-7-12/h4-5,8-9H,3,6-7,11H2,1-2H3 |
| InChIKey | JYUUCEVKOOBPLE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 205 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|