C9H19NO3 — CID 44421758
N-[(2S)-1,3-Dihydroxybutan-2-yl]-3-methylbutanamide (PubChem CID 44421758) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is N-[(2S)-1,3-dihydroxybutan-2-yl]-3-methylbutanamide.
| Compound Name | N-[(2S)-1,3-Dihydroxybutan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 44421758 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N-[(2S)-1,3-dihydroxybutan-2-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)N[C@@H](CO)C(C)O |
| InChI | InChI=1S/C9H19NO3/c1-6(2)4-9(13)10-8(5-11)7(3)12/h6-8,11-12H,4-5H2,1-3H3,(H,10,13)/t7?,8-/m0/s1 |
| InChIKey | PKDWJPAZIMVYTQ-MQWKRIRWSA-N |
| XLogP | -0.10 |
| TPSA | 69.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | 159 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |