C11H23NO2 — CID 71916902
N-(2-hydroxy-3-methylbutyl)-3,3-dimethylbutanamide (PubChem CID 71916902) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is N-(2-hydroxy-3-methylbutyl)-3,3-dimethylbutanamide.
| Compound Name | N-(2-hydroxy-3-methylbutyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 71916902 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N-(2-hydroxy-3-methylbutyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)C(O)CNC(=O)CC(C)(C)C |
| InChI | InChI=1S/C11H23NO2/c1-8(2)9(13)7-12-10(14)6-11(3,4)5/h8-9,13H,6-7H2,1-5H3,(H,12,14) |
| InChIKey | LFSMVGLFOYFMCN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |