C20H19NO2 — CID 44473508
2-[Benzyl(naphthalen-2-ylmethyl)amino]acetic acid (PubChem CID 44473508) has the molecular formula C20H19NO2 and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-[benzyl(naphthalen-2-ylmethyl)amino]acetic acid.
| Compound Name | 2-[Benzyl(naphthalen-2-ylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 44473508 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[benzyl(naphthalen-2-ylmethyl)amino]acetic acid |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC3=CC=CC=C3C=C2)CC(=O)O |
| InChI | InChI=1S/C20H19NO2/c22-20(23)15-21(13-16-6-2-1-3-7-16)14-17-10-11-18-8-4-5-9-19(18)12-17/h1-12H,13-15H2,(H,22,23) |
| InChIKey | FCIDUHFPXNZFRV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | 378 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |