C23H30N2O2 — CID 68632816
2-[[4-(dimethylamino)-1,4-diphenylcyclohexyl]-methylamino]acetic acid (PubChem CID 68632816) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-1,4-diphenylcyclohexyl]-methylamino]acetic acid.
| Compound Name | 2-[[4-(dimethylamino)-1,4-diphenylcyclohexyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 68632816 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-[[4-(dimethylamino)-1,4-diphenylcyclohexyl]-methylamino]acetic acid |
| SMILES | CN(C)C1(c2ccccc2)CCC(c2ccccc2)(N(C)CC(=O)O)CC1 |
| InChI | InChI=1S/C23H30N2O2/c1-24(2)22(19-10-6-4-7-11-19)14-16-23(17-15-22,25(3)18-21(26)27)20-12-8-5-9-13-20/h4-13H,14-18H2,1-3H3,(H,26,27) |
| InChIKey | JUTCENALRFKHNY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |