C13H16BrN3O3 — CID 44506449
N-[(E)-(2-bromophenyl)methylideneamino]-N'-hydroxyhexanediamide (PubChem CID 44506449) has the molecular formula C13H16BrN3O3 and a molecular weight of 342.19 g/mol. Its IUPAC name is N-[(E)-(2-bromophenyl)methylideneamino]-N'-hydroxyhexanediamide.
| Compound Name | N-[(E)-(2-bromophenyl)methylideneamino]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 44506449 |
| Molecular Formula | C13H16BrN3O3 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-[(E)-(2-bromophenyl)methylideneamino]-N'-hydroxyhexanediamide |
| SMILES | O=C(CCCCC(=O)N/N=C/c1ccccc1Br)NO |
| InChI | InChI=1S/C13H16BrN3O3/c14-11-6-2-1-5-10(11)9-15-16-12(18)7-3-4-8-13(19)17-20/h1-2,5-6,9,20H,3-4,7-8H2,(H,16,18)(H,17,19)/b15-9+ |
| InChIKey | IUAHKRKBKYPKPD-OQLLNIDSSA-N |
| XLogP | 1.97 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|