C13H17BrN4O3 — CID 44507860
N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide (PubChem CID 44507860) has the molecular formula C13H17BrN4O3 and a molecular weight of 357.21 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide.
| Compound Name | N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 44507860 |
| Molecular Formula | C13H17BrN4O3 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)N/N=C/c1ccncc1Br)NO |
| InChI | InChI=1S/C13H17BrN4O3/c14-11-9-15-7-6-10(11)8-16-17-12(19)4-2-1-3-5-13(20)18-21/h6-9,21H,1-5H2,(H,17,19)(H,18,20)/b16-8+ |
| InChIKey | RJRYBHNPYZRWRE-LZYBPNLTSA-N |
| XLogP | 1.75 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|