About N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide
N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide (PubChem CID 44507860) has the molecular formula C13H17BrN4O3
and a molecular weight of 357.21 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide.
Molecular Properties
| Compound Name | N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide |
| PubChem CID | 44507860 |
| Molecular Formula | C13H17BrN4O3 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)N/N=C/c1ccncc1Br)NO |
| InChI | InChI=1S/C13H17BrN4O3/c14-11-9-15-7-6-10(11)8-16-17-12(19)4-2-1-3-5-13(20)18-21/h6-9,21H,1-5H2,(H,17,19)(H,18,20)/b16-8+ |
| InChIKey | RJRYBHNPYZRWRE-LZYBPNLTSA-N |
| XLogP | 1.75 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide?
The IUPAC name of N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide (CID 44507860) is N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide.
What is the SMILES notation for N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide?
The canonical SMILES for N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide is O=C(CCCCCC(=O)N/N=C/c1ccncc1Br)NO.
What is the InChIKey of N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide?
The InChIKey is RJRYBHNPYZRWRE-LZYBPNLTSA-N. The full InChI is InChI=1S/C13H17BrN4O3/c14-11-9-15-7-6-10(11)8-16-17-12(19)4-2-1-3-5-13(20)18-21/h6-9,21H,1-5H2,(H,17,19)(H,18,20)/b16-8+.
What are the key properties of N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide?
N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide has a molecular weight of 357.21 g/mol, XLogP of 1.75, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-(3-bromo-4-pyridinyl)methylideneamino]-N'-hydroxyheptanediamide is sourced from PubChem (CID 44507860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).