C14H14F5N3O3 — CID 44507876
N'-hydroxy-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]heptanediamide (PubChem CID 44507876) has the molecular formula C14H14F5N3O3 and a molecular weight of 367.27 g/mol. Its IUPAC name is N'-hydroxy-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]heptanediamide.
| Compound Name | N'-hydroxy-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]heptanediamide |
|---|---|
| PubChem CID | 44507876 |
| Molecular Formula | C14H14F5N3O3 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N'-hydroxy-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]heptanediamide |
| SMILES | O=C(CCCCCC(=O)N/N=C/c1c(F)c(F)c(F)c(F)c1F)NO |
| InChI | InChI=1S/C14H14F5N3O3/c15-10-7(11(16)13(18)14(19)12(10)17)6-20-21-8(23)4-2-1-3-5-9(24)22-25/h6,25H,1-5H2,(H,21,23)(H,22,24)/b20-6+ |
| InChIKey | CEMNSLJSFLQFSB-CGOBSMCZSA-N |
| XLogP | 2.29 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|