C25H24O3 — CID 44511263
ethyl (1S,5S,8E)-8-benzylidene-9-oxo-1-phenylspiro[4.4]non-3-ene-4-carboxylate (PubChem CID 44511263) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is ethyl (1S,5S,8E)-8-benzylidene-9-oxo-1-phenylspiro[4.4]non-3-ene-4-carboxylate.
| Compound Name | ethyl (1S,5S,8E)-8-benzylidene-9-oxo-1-phenylspiro[4.4]non-3-ene-4-carboxylate |
|---|---|
| PubChem CID | 44511263 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | ethyl (1S,5S,8E)-8-benzylidene-9-oxo-1-phenylspiro[4.4]non-3-ene-4-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@@H](c2ccccc2)[C@@]12CC/C(=C\c1ccccc1)C2=O |
| InChI | InChI=1S/C25H24O3/c1-2-28-24(27)22-14-13-21(19-11-7-4-8-12-19)25(22)16-15-20(23(25)26)17-18-9-5-3-6-10-18/h3-12,14,17,21H,2,13,15-16H2,1H3/b20-17+/t21-,25-/m0/s1 |
| InChIKey | KXVNAAYAKGJVOX-AFBBGLSWSA-N |
| XLogP | 5.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|