C31H38ClF2N5O2 — CID 44512240
6-chloro-N-[(3R)-3-[4-[3,5-difluoro-4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 44512240) has the molecular formula C31H38ClF2N5O2 and a molecular weight of 586.13 g/mol. Its IUPAC name is 6-chloro-N-[(3R)-3-[4-[3,5-difluoro-4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[(3R)-3-[4-[3,5-difluoro-4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 44512240 |
| Molecular Formula | C31H38ClF2N5O2 |
| Molecular Weight | 586.13 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | 6-chloro-N-[(3R)-3-[4-[3,5-difluoro-4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | COc1c(F)cc(N(Cc2cnccc2C)C2CCN([C@H](C)CCNC(=O)c3c(C)cc(Cl)nc3C)CC2)cc1F |
| InChI | InChI=1S/C31H38ClF2N5O2/c1-19-6-10-35-17-23(19)18-39(25-15-26(33)30(41-5)27(34)16-25)24-8-12-38(13-9-24)21(3)7-11-36-31(40)29-20(2)14-28(32)37-22(29)4/h6,10,14-17,21,24H,7-9,11-13,18H2,1-5H3,(H,36,40)/t21-/m1/s1 |
| InChIKey | ICBDGJCCYFBTSZ-OAQYLSRUSA-N |
| XLogP | 6.02 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.13 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|