C30H37ClFN5O2 — CID 75037830
6-chloro-N-[3-[4-[N-[(6-fluoro-2-pyridinyl)methyl]-4-methoxyanilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 75037830) has the molecular formula C30H37ClFN5O2 and a molecular weight of 554.11 g/mol. Its IUPAC name is 6-chloro-N-[3-[4-[N-[(6-fluoro-2-pyridinyl)methyl]-4-methoxyanilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[3-[4-[N-[(6-fluoro-2-pyridinyl)methyl]-4-methoxyanilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 75037830 |
| Molecular Formula | C30H37ClFN5O2 |
| Molecular Weight | 554.11 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 6-chloro-N-[3-[4-[N-[(6-fluoro-2-pyridinyl)methyl]-4-methoxyanilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | COc1ccc(N(Cc2cccc(F)n2)C2CCN(C(C)CCNC(=O)c3c(C)cc(Cl)nc3C)CC2)cc1 |
| InChI | InChI=1S/C30H37ClFN5O2/c1-20-18-27(31)34-22(3)29(20)30(38)33-15-12-21(2)36-16-13-25(14-17-36)37(19-23-6-5-7-28(32)35-23)24-8-10-26(39-4)11-9-24/h5-11,18,21,25H,12-17,19H2,1-4H3,(H,33,38) |
| InChIKey | WSFCWAINCMMHEP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.11 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|