C34H45N5O4 — CID 76611835
4-N-methoxy-1-N-[3-[4-[4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,6-dimethylbenzene-1,4-dicarboxamide (PubChem CID 76611835) has the molecular formula C34H45N5O4 and a molecular weight of 587.77 g/mol. Its IUPAC name is 4-N-methoxy-1-N-[3-[4-[4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,6-dimethylbenzene-1,4-dicarboxamide.
| Compound Name | 4-N-methoxy-1-N-[3-[4-[4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,6-dimethylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 76611835 |
| Molecular Formula | C34H45N5O4 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 4-N-methoxy-1-N-[3-[4-[4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,6-dimethylbenzene-1,4-dicarboxamide |
| SMILES | CONC(=O)c1cc(C)c(C(=O)NCCC(C)N2CCC(N(Cc3cnccc3C)c3ccc(OC)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C34H45N5O4/c1-23-11-15-35-21-28(23)22-39(29-7-9-31(42-5)10-8-29)30-13-17-38(18-14-30)26(4)12-16-36-34(41)32-24(2)19-27(20-25(32)3)33(40)37-43-6/h7-11,15,19-21,26,30H,12-14,16-18,22H2,1-6H3,(H,36,41)(H,37,40) |
| InChIKey | HGIRMYVVCRKUCP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|