C31H41N5O2 — CID 89201570
4-amino-N-[(3R)-3-[4-[4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2-methylbenzamide (PubChem CID 89201570) has the molecular formula C31H41N5O2 and a molecular weight of 515.70 g/mol. Its IUPAC name is 4-amino-N-[(3R)-3-[4-[4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2-methylbenzamide.
| Compound Name | 4-amino-N-[(3R)-3-[4-[4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 89201570 |
| Molecular Formula | C31H41N5O2 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.33 |
| IUPAC Name | 4-amino-N-[(3R)-3-[4-[4-methoxy-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2-methylbenzamide |
| SMILES | COc1ccc(N(Cc2cnccc2C)C2CCN([C@H](C)CCNC(=O)c3ccc(N)cc3C)CC2)cc1 |
| InChI | InChI=1S/C31H41N5O2/c1-22-11-15-33-20-25(22)21-36(27-6-8-29(38-4)9-7-27)28-13-17-35(18-14-28)24(3)12-16-34-31(37)30-10-5-26(32)19-23(30)2/h5-11,15,19-20,24,28H,12-14,16-18,21,32H2,1-4H3,(H,34,37)/t24-/m1/s1 |
| InChIKey | MCIQINOQNGGOOU-XMMPIXPASA-N |
| XLogP | 4.97 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|