C33H44N6O2 — CID 91039602
N-[3-[4-[4-[1-(methoxyamino)ethenyl]-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 91039602) has the molecular formula C33H44N6O2 and a molecular weight of 556.76 g/mol. Its IUPAC name is N-[3-[4-[4-[1-(methoxyamino)ethenyl]-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | N-[3-[4-[4-[1-(methoxyamino)ethenyl]-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 91039602 |
| Molecular Formula | C33H44N6O2 |
| Molecular Weight | 556.76 g/mol |
| Exact Mass | 556.35 |
| IUPAC Name | N-[3-[4-[4-[1-(methoxyamino)ethenyl]-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | C=C(NOC)c1ccc(N(Cc2cnccc2C)C2CCN(C(C)CCNC(=O)c3c(C)ccnc3C)CC2)cc1 |
| InChI | InChI=1S/C33H44N6O2/c1-23-11-16-34-21-29(23)22-39(30-9-7-28(8-10-30)26(4)37-41-6)31-14-19-38(20-15-31)25(3)13-18-36-33(40)32-24(2)12-17-35-27(32)5/h7-12,16-17,21,25,31,37H,4,13-15,18-20,22H2,1-3,5-6H3,(H,36,40) |
| InChIKey | KGCGXYSVCKQHGB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.76 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|