C32H40ClN5O3 — CID 59458059
N-[3-[4-[benzyl-[(2-methoxyphenyl)carbamoyl]amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide (PubChem CID 59458059) has the molecular formula C32H40ClN5O3 and a molecular weight of 578.16 g/mol. Its IUPAC name is N-[3-[4-[benzyl-[(2-methoxyphenyl)carbamoyl]amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | N-[3-[4-[benzyl-[(2-methoxyphenyl)carbamoyl]amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 59458059 |
| Molecular Formula | C32H40ClN5O3 |
| Molecular Weight | 578.16 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | N-[3-[4-[benzyl-[(2-methoxyphenyl)carbamoyl]amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide |
| SMILES | COc1ccccc1NC(=O)N(Cc1ccccc1)C1CCN(C(C)CCNC(=O)c2c(C)cc(Cl)nc2C)CC1 |
| InChI | InChI=1S/C32H40ClN5O3/c1-22-20-29(33)35-24(3)30(22)31(39)34-17-14-23(2)37-18-15-26(16-19-37)38(21-25-10-6-5-7-11-25)32(40)36-27-12-8-9-13-28(27)41-4/h5-13,20,23,26H,14-19,21H2,1-4H3,(H,34,39)(H,36,40) |
| InChIKey | QGCASXHKIPXQHO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.16 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|