C27H37ClN6OS — CID 89014915
6-chloro-N-[(3R)-3-[4-[[(E)-2-cyano-1-(ethylamino)ethenyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 89014915) has the molecular formula C27H37ClN6OS and a molecular weight of 529.15 g/mol. Its IUPAC name is 6-chloro-N-[(3R)-3-[4-[[(E)-2-cyano-1-(ethylamino)ethenyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[(3R)-3-[4-[[(E)-2-cyano-1-(ethylamino)ethenyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 89014915 |
| Molecular Formula | C27H37ClN6OS |
| Molecular Weight | 529.15 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 6-chloro-N-[(3R)-3-[4-[[(E)-2-cyano-1-(ethylamino)ethenyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | CCN/C(=C\C#N)N(Cc1ccsc1)C1CCN([C@H](C)CCNC(=O)c2c(C)cc(Cl)nc2C)CC1 |
| InChI | InChI=1S/C27H37ClN6OS/c1-5-30-25(6-11-29)34(17-22-10-15-36-18-22)23-8-13-33(14-9-23)20(3)7-12-31-27(35)26-19(2)16-24(28)32-21(26)4/h6,10,15-16,18,20,23,30H,5,7-9,12-14,17H2,1-4H3,(H,31,35)/b25-6+/t20-/m1/s1 |
| InChIKey | LDPGGNWYUVLMDP-RRVGCWJASA-N |
| XLogP | 4.86 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.15 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|