C25H34N6O3S — CID 15941082
6-cyano-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 15941082) has the molecular formula C25H34N6O3S and a molecular weight of 498.65 g/mol. Its IUPAC name is 6-cyano-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 6-cyano-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 15941082 |
| Molecular Formula | C25H34N6O3S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 6-cyano-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | CONC(=O)N(Cc1ccsc1)C1CCN([C@H](C)CCNC(=O)c2c(C)cc(C#N)nc2C)CC1 |
| InChI | InChI=1S/C25H34N6O3S/c1-17-13-21(14-26)28-19(3)23(17)24(32)27-9-5-18(2)30-10-6-22(7-11-30)31(25(33)29-34-4)15-20-8-12-35-16-20/h8,12-13,16,18,22H,5-7,9-11,15H2,1-4H3,(H,27,32)(H,29,33)/t18-/m1/s1 |
| InChIKey | MWWRDBSYIXPDNL-GOSISDBHSA-N |
| XLogP | 3.38 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|