C26H41N9O3S — CID 143378881
6-[1-amino-1-[(Z)-aminodiazenyl]ethyl]-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 143378881) has the molecular formula C26H41N9O3S and a molecular weight of 559.74 g/mol. Its IUPAC name is 6-[1-amino-1-[(Z)-aminodiazenyl]ethyl]-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 6-[1-amino-1-[(Z)-aminodiazenyl]ethyl]-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 143378881 |
| Molecular Formula | C26H41N9O3S |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | 6-[1-amino-1-[(Z)-aminodiazenyl]ethyl]-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | CONC(=O)N(Cc1ccsc1)C1CCN([C@H](C)CCNC(=O)c2c(C)cc(C(C)(N)/N=N\N)nc2C)CC1 |
| InChI | InChI=1S/C26H41N9O3S/c1-17-14-22(26(4,27)32-33-28)30-19(3)23(17)24(36)29-10-6-18(2)34-11-7-21(8-12-34)35(25(37)31-38-5)15-20-9-13-39-16-20/h9,13-14,16,18,21H,6-8,10-12,15,27H2,1-5H3,(H2,28,32)(H,29,36)(H,31,37)/t18-,26?/m1/s1 |
| InChIKey | RTEHWCKINFECBH-QOBPCVTDSA-N |
| XLogP | 2.96 |
| TPSA | 163.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|