C23H31Cl2N5O4S — CID 91514424
2,6-dichloro-N-hydroxy-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide (PubChem CID 91514424) has the molecular formula C23H31Cl2N5O4S and a molecular weight of 544.51 g/mol. Its IUPAC name is 2,6-dichloro-N-hydroxy-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-hydroxy-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 91514424 |
| Molecular Formula | C23H31Cl2N5O4S |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 2,6-dichloro-N-hydroxy-N-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide |
| SMILES | CONC(=O)N(Cc1ccsc1)C1CCN([C@H](C)CCN(O)C(=O)c2c(C)cc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C23H31Cl2N5O4S/c1-15-12-19(24)26-21(25)20(15)22(31)30(33)10-4-16(2)28-8-5-18(6-9-28)29(23(32)27-34-3)13-17-7-11-35-14-17/h7,11-12,14,16,18,33H,4-6,8-10,13H2,1-3H3,(H,27,32)/t16-/m1/s1 |
| InChIKey | ARHJTOLMDAOUIU-MRXNPFEDSA-N |
| XLogP | 4.61 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|