C23H30Cl2N4O2S — CID 59590696
1-[1-[(2R)-6-(2,6-dichloro-4-methyl-3-pyridinyl)-6-oxohexan-2-yl]piperidin-4-yl]-1-(thiophen-3-ylmethyl)urea (PubChem CID 59590696) has the molecular formula C23H30Cl2N4O2S and a molecular weight of 497.49 g/mol. Its IUPAC name is 1-[1-[(2R)-6-(2,6-dichloro-4-methyl-3-pyridinyl)-6-oxohexan-2-yl]piperidin-4-yl]-1-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-[1-[(2R)-6-(2,6-dichloro-4-methyl-3-pyridinyl)-6-oxohexan-2-yl]piperidin-4-yl]-1-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 59590696 |
| Molecular Formula | C23H30Cl2N4O2S |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-[1-[(2R)-6-(2,6-dichloro-4-methyl-3-pyridinyl)-6-oxohexan-2-yl]piperidin-4-yl]-1-(thiophen-3-ylmethyl)urea |
| SMILES | Cc1cc(Cl)nc(Cl)c1C(=O)CCC[C@@H](C)N1CCC(N(Cc2ccsc2)C(N)=O)CC1 |
| InChI | InChI=1S/C23H30Cl2N4O2S/c1-15-12-20(24)27-22(25)21(15)19(30)5-3-4-16(2)28-9-6-18(7-10-28)29(23(26)31)13-17-8-11-32-14-17/h8,11-12,14,16,18H,3-7,9-10,13H2,1-2H3,(H2,26,31)/t16-/m1/s1 |
| InChIKey | RXJNMFMCYQNJDP-MRXNPFEDSA-N |
| XLogP | 5.55 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|