C23H33N5O3S — CID 140535065
6-[(3R)-3-[4-[hydroxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 140535065) has the molecular formula C23H33N5O3S and a molecular weight of 459.62 g/mol. Its IUPAC name is 6-[(3R)-3-[4-[hydroxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 6-[(3R)-3-[4-[hydroxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 140535065 |
| Molecular Formula | C23H33N5O3S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 6-[(3R)-3-[4-[hydroxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(CC[C@@H](C)N2CCC(N(Cc3ccsc3)C(=O)NO)CC2)nc(C)c1C(N)=O |
| InChI | InChI=1S/C23H33N5O3S/c1-15-12-19(25-17(3)21(15)22(24)29)5-4-16(2)27-9-6-20(7-10-27)28(23(30)26-31)13-18-8-11-32-14-18/h8,11-12,14,16,20,31H,4-7,9-10,13H2,1-3H3,(H2,24,29)(H,26,30)/t16-/m1/s1 |
| InChIKey | GUTBPFHFMNAQGJ-MRXNPFEDSA-N |
| XLogP | 3.25 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|