C24H34N4O2S2 — CID 140535015
2-[(3R)-3-[4-[(2-methoxyethanethioyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide (PubChem CID 140535015) has the molecular formula C24H34N4O2S2 and a molecular weight of 474.70 g/mol. Its IUPAC name is 2-[(3R)-3-[4-[(2-methoxyethanethioyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide.
| Compound Name | 2-[(3R)-3-[4-[(2-methoxyethanethioyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 140535015 |
| Molecular Formula | C24H34N4O2S2 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-[(3R)-3-[4-[(2-methoxyethanethioyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide |
| SMILES | COCC(=S)N(Cc1ccsc1)C1CCN([C@H](C)CCc2nccc(C)c2C(N)=O)CC1 |
| InChI | InChI=1S/C24H34N4O2S2/c1-17-6-10-26-21(23(17)24(25)29)5-4-18(2)27-11-7-20(8-12-27)28(22(31)15-30-3)14-19-9-13-32-16-19/h6,9-10,13,16,18,20H,4-5,7-8,11-12,14-15H2,1-3H3,(H2,25,29)/t18-/m1/s1 |
| InChIKey | IVBSRXAIKMLGPA-GOSISDBHSA-N |
| XLogP | 3.81 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|