C22H32N4OS — CID 68774075
N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-3-pyridin-4-yl-N-(thiophen-3-ylmethyl)propanamide (PubChem CID 68774075) has the molecular formula C22H32N4OS and a molecular weight of 400.59 g/mol. Its IUPAC name is N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-3-pyridin-4-yl-N-(thiophen-3-ylmethyl)propanamide.
| Compound Name | N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-3-pyridin-4-yl-N-(thiophen-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 68774075 |
| Molecular Formula | C22H32N4OS |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-3-pyridin-4-yl-N-(thiophen-3-ylmethyl)propanamide |
| SMILES | CC(CCN)N1CCC(N(Cc2ccsc2)C(=O)CCc2ccncc2)CC1 |
| InChI | InChI=1S/C22H32N4OS/c1-18(4-10-23)25-13-7-21(8-14-25)26(16-20-9-15-28-17-20)22(27)3-2-19-5-11-24-12-6-19/h5-6,9,11-12,15,17-18,21H,2-4,7-8,10,13-14,16,23H2,1H3 |
| InChIKey | WTIHWKGKCVVEEO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |