C23H39N3OS — CID 68774007
N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-3-cyclohexyl-N-(thiophen-3-ylmethyl)propanamide (PubChem CID 68774007) has the molecular formula C23H39N3OS and a molecular weight of 405.65 g/mol. Its IUPAC name is N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-3-cyclohexyl-N-(thiophen-3-ylmethyl)propanamide.
| Compound Name | N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-3-cyclohexyl-N-(thiophen-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 68774007 |
| Molecular Formula | C23H39N3OS |
| Molecular Weight | 405.65 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-3-cyclohexyl-N-(thiophen-3-ylmethyl)propanamide |
| SMILES | CC(CCN)N1CCC(N(Cc2ccsc2)C(=O)CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H39N3OS/c1-19(9-13-24)25-14-10-22(11-15-25)26(17-21-12-16-28-18-21)23(27)8-7-20-5-3-2-4-6-20/h12,16,18-20,22H,2-11,13-15,17,24H2,1H3 |
| InChIKey | MMCFYOQCSASMRV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |