C21H30N4S3 — CID 87569578
N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-2-pyridin-4-ylsulfanyl-N-(thiophen-3-ylmethyl)ethanethioamide (PubChem CID 87569578) has the molecular formula C21H30N4S3 and a molecular weight of 434.70 g/mol. Its IUPAC name is N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-2-pyridin-4-ylsulfanyl-N-(thiophen-3-ylmethyl)ethanethioamide.
| Compound Name | N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-2-pyridin-4-ylsulfanyl-N-(thiophen-3-ylmethyl)ethanethioamide |
|---|---|
| PubChem CID | 87569578 |
| Molecular Formula | C21H30N4S3 |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-2-pyridin-4-ylsulfanyl-N-(thiophen-3-ylmethyl)ethanethioamide |
| SMILES | CC(CCN)N1CCC(N(Cc2ccsc2)C(=S)CSc2ccncc2)CC1 |
| InChI | InChI=1S/C21H30N4S3/c1-17(2-8-22)24-11-5-19(6-12-24)25(14-18-7-13-27-15-18)21(26)16-28-20-3-9-23-10-4-20/h3-4,7,9-10,13,15,17,19H,2,5-6,8,11-12,14,16,22H2,1H3 |
| InChIKey | QLMWRTARDJYCRM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|