C22H32N4O2S — CID 68974012
2-[4-[[1-[(2R)-4-aminobutan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)amino]phenoxy]acetamide (PubChem CID 68974012) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is 2-[4-[[1-[(2R)-4-aminobutan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)amino]phenoxy]acetamide.
| Compound Name | 2-[4-[[1-[(2R)-4-aminobutan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 68974012 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2-[4-[[1-[(2R)-4-aminobutan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)amino]phenoxy]acetamide |
| SMILES | C[C@H](CCN)N1CCC(N(Cc2ccsc2)c2ccc(OCC(N)=O)cc2)CC1 |
| InChI | InChI=1S/C22H32N4O2S/c1-17(6-10-23)25-11-7-20(8-12-25)26(14-18-9-13-29-16-18)19-2-4-21(5-3-19)28-15-22(24)27/h2-5,9,13,16-17,20H,6-8,10-12,14-15,23H2,1H3,(H2,24,27)/t17-/m1/s1 |
| InChIKey | CRAWETDTEMOVRC-QGZVFWFLSA-N |
| XLogP | 2.82 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|