C24H32N4O3S — CID 87639007
[4-[[1-(4-aminobutan-2-yl)piperidin-4-yl]-[(3-cyanophenyl)methyl]amino]phenyl] methanesulfonate (PubChem CID 87639007) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is [4-[[1-(4-aminobutan-2-yl)piperidin-4-yl]-[(3-cyanophenyl)methyl]amino]phenyl] methanesulfonate.
| Compound Name | [4-[[1-(4-aminobutan-2-yl)piperidin-4-yl]-[(3-cyanophenyl)methyl]amino]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 87639007 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | [4-[[1-(4-aminobutan-2-yl)piperidin-4-yl]-[(3-cyanophenyl)methyl]amino]phenyl] methanesulfonate |
| SMILES | CC(CCN)N1CCC(N(Cc2cccc(C#N)c2)c2ccc(OS(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C24H32N4O3S/c1-19(10-13-25)27-14-11-23(12-15-27)28(18-21-5-3-4-20(16-21)17-26)22-6-8-24(9-7-22)31-32(2,29)30/h3-9,16,19,23H,10-15,18,25H2,1-2H3 |
| InChIKey | NBPRXFCFJVVAIH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|