C33H41N6O2+ — CID 143065508
N-[3-[4-[N-[(3-cyanophenyl)methyl]-4-ethanimidoylanilino]piperidin-1-yl]butyl]-1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxamide (PubChem CID 143065508) has the molecular formula C33H41N6O2+ and a molecular weight of 553.73 g/mol. Its IUPAC name is N-[3-[4-[N-[(3-cyanophenyl)methyl]-4-ethanimidoylanilino]piperidin-1-yl]butyl]-1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxamide.
| Compound Name | N-[3-[4-[N-[(3-cyanophenyl)methyl]-4-ethanimidoylanilino]piperidin-1-yl]butyl]-1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 143065508 |
| Molecular Formula | C33H41N6O2+ |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | N-[3-[4-[N-[(3-cyanophenyl)methyl]-4-ethanimidoylanilino]piperidin-1-yl]butyl]-1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxamide |
| SMILES | [H]/N=C(\C)c1ccc(N(Cc2cccc(C#N)c2)C2CCN(C(C)CCNC(=O)c3c(C)cc[n+](O)c3C)CC2)cc1 |
| InChI | InChI=1S/C33H40N6O2/c1-23-13-19-39(41)26(4)32(23)33(40)36-16-12-24(2)37-17-14-31(15-18-37)38(22-28-7-5-6-27(20-28)21-34)30-10-8-29(9-11-30)25(3)35/h5-11,13,19-20,24,31,35H,12,14-18,22H2,1-4H3,(H-,36,40,41)/p+1/b35-25+ |
| InChIKey | SHJXNAVKTMOKFS-KVQDIILNSA-O |
| XLogP | 4.77 |
| TPSA | 107.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|