C29H44N4OSi — CID 68970186
3-[[N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-4-[tert-butyl(dimethyl)silyl]oxyanilino]methyl]benzonitrile (PubChem CID 68970186) has the molecular formula C29H44N4OSi and a molecular weight of 492.78 g/mol. Its IUPAC name is 3-[[N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-4-[tert-butyl(dimethyl)silyl]oxyanilino]methyl]benzonitrile.
| Compound Name | 3-[[N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-4-[tert-butyl(dimethyl)silyl]oxyanilino]methyl]benzonitrile |
|---|---|
| PubChem CID | 68970186 |
| Molecular Formula | C29H44N4OSi |
| Molecular Weight | 492.78 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | 3-[[N-[1-(4-aminobutan-2-yl)piperidin-4-yl]-4-[tert-butyl(dimethyl)silyl]oxyanilino]methyl]benzonitrile |
| SMILES | CC(CCN)N1CCC(N(Cc2cccc(C#N)c2)c2ccc(O[Si](C)(C)C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C29H44N4OSi/c1-23(14-17-30)32-18-15-27(16-19-32)33(22-25-9-7-8-24(20-25)21-31)26-10-12-28(13-11-26)34-35(5,6)29(2,3)4/h7-13,20,23,27H,14-19,22,30H2,1-6H3 |
| InChIKey | WJDPJWCMFDUCDN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.78 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|