C21H30N4O2S — CID 68968829
(3R)-3-[4-[(6-ethoxy-3-pyridinyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butanamide (PubChem CID 68968829) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is (3R)-3-[4-[(6-ethoxy-3-pyridinyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butanamide.
| Compound Name | (3R)-3-[4-[(6-ethoxy-3-pyridinyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butanamide |
|---|---|
| PubChem CID | 68968829 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (3R)-3-[4-[(6-ethoxy-3-pyridinyl)-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butanamide |
| SMILES | CCOc1ccc(N(Cc2ccsc2)C2CCN([C@H](C)CC(N)=O)CC2)cn1 |
| InChI | InChI=1S/C21H30N4O2S/c1-3-27-21-5-4-19(13-23-21)25(14-17-8-11-28-15-17)18-6-9-24(10-7-18)16(2)12-20(22)26/h4-5,8,11,13,15-16,18H,3,6-7,9-10,12,14H2,1-2H3,(H2,22,26)/t16-/m1/s1 |
| InChIKey | SBGDAFFBAPICGQ-MRXNPFEDSA-N |
| XLogP | 3.28 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |