C30H39N5O3S — CID 140534991
3-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,6-dimethyl-4-pyridin-4-ylbenzamide (PubChem CID 140534991) has the molecular formula C30H39N5O3S and a molecular weight of 549.74 g/mol. Its IUPAC name is 3-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,6-dimethyl-4-pyridin-4-ylbenzamide.
| Compound Name | 3-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,6-dimethyl-4-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 140534991 |
| Molecular Formula | C30H39N5O3S |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | 3-[(3R)-3-[4-[methoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,6-dimethyl-4-pyridin-4-ylbenzamide |
| SMILES | CONC(=O)N(Cc1ccsc1)C1CCN([C@H](C)CCc2c(-c3ccncc3)cc(C)c(C(N)=O)c2C)CC1 |
| InChI | InChI=1S/C30H39N5O3S/c1-20-17-27(24-7-12-32-13-8-24)26(22(3)28(20)29(31)36)6-5-21(2)34-14-9-25(10-15-34)35(30(37)33-38-4)18-23-11-16-39-19-23/h7-8,11-13,16-17,19,21,25H,5-6,9-10,14-15,18H2,1-4H3,(H2,31,36)(H,33,37)/t21-/m1/s1 |
| InChIKey | SDNKLYOUFKTPPZ-OAQYLSRUSA-N |
| XLogP | 5.08 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|