C16H28N4O2S — CID 91283939
1-[1-(3-aminobutyl)piperidin-4-yl]-3-methoxy-1-(thiophen-3-ylmethyl)urea (PubChem CID 91283939) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-[1-(3-aminobutyl)piperidin-4-yl]-3-methoxy-1-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-[1-(3-aminobutyl)piperidin-4-yl]-3-methoxy-1-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 91283939 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-[1-(3-aminobutyl)piperidin-4-yl]-3-methoxy-1-(thiophen-3-ylmethyl)urea |
| SMILES | CONC(=O)N(Cc1ccsc1)C1CCN(CCC(C)N)CC1 |
| InChI | InChI=1S/C16H28N4O2S/c1-13(17)3-7-19-8-4-15(5-9-19)20(16(21)18-22-2)11-14-6-10-23-12-14/h6,10,12-13,15H,3-5,7-9,11,17H2,1-2H3,(H,18,21) |
| InChIKey | RYNCDKRFSUESQK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|