C20H34N4OS — CID 122559774
1-cyclopentyl-3-[3-(4-ethylpiperazin-1-yl)propyl]-1-(thiophen-3-ylmethyl)urea (PubChem CID 122559774) has the molecular formula C20H34N4OS and a molecular weight of 378.59 g/mol. Its IUPAC name is 1-cyclopentyl-3-[3-(4-ethylpiperazin-1-yl)propyl]-1-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-cyclopentyl-3-[3-(4-ethylpiperazin-1-yl)propyl]-1-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 122559774 |
| Molecular Formula | C20H34N4OS |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 1-cyclopentyl-3-[3-(4-ethylpiperazin-1-yl)propyl]-1-(thiophen-3-ylmethyl)urea |
| SMILES | CCN1CCN(CCCNC(=O)N(Cc2ccsc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C20H34N4OS/c1-2-22-11-13-23(14-12-22)10-5-9-21-20(25)24(19-6-3-4-7-19)16-18-8-15-26-17-18/h8,15,17,19H,2-7,9-14,16H2,1H3,(H,21,25) |
| InChIKey | AETDMPRDWNRAKT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|