C24H33Cl2N5O3S — CID 15942350
2,6-dichloro-N-[(3R)-3-[4-[ethoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide (PubChem CID 15942350) has the molecular formula C24H33Cl2N5O3S and a molecular weight of 542.53 g/mol. Its IUPAC name is 2,6-dichloro-N-[(3R)-3-[4-[ethoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[(3R)-3-[4-[ethoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 15942350 |
| Molecular Formula | C24H33Cl2N5O3S |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 2,6-dichloro-N-[(3R)-3-[4-[ethoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4-methylpyridine-3-carboxamide |
| SMILES | CCONC(=O)N(Cc1ccsc1)C1CCN([C@H](C)CCNC(=O)c2c(C)cc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C24H33Cl2N5O3S/c1-4-34-29-24(33)31(14-18-8-12-35-15-18)19-6-10-30(11-7-19)17(3)5-9-27-23(32)21-16(2)13-20(25)28-22(21)26/h8,12-13,15,17,19H,4-7,9-11,14H2,1-3H3,(H,27,32)(H,29,33)/t17-/m1/s1 |
| InChIKey | BXRRJVASTHGPKA-QGZVFWFLSA-N |
| XLogP | 4.89 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|