C27H34ClN7OS — CID 89015145
2-chloro-N-[(3R)-3-[4-[[2,2-dicyano-1-(methylamino)ethenyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4,6-dimethylpyridine-3-carboxamide (PubChem CID 89015145) has the molecular formula C27H34ClN7OS and a molecular weight of 540.14 g/mol. Its IUPAC name is 2-chloro-N-[(3R)-3-[4-[[2,2-dicyano-1-(methylamino)ethenyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4,6-dimethylpyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(3R)-3-[4-[[2,2-dicyano-1-(methylamino)ethenyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 89015145 |
| Molecular Formula | C27H34ClN7OS |
| Molecular Weight | 540.14 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 2-chloro-N-[(3R)-3-[4-[[2,2-dicyano-1-(methylamino)ethenyl]-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4,6-dimethylpyridine-3-carboxamide |
| SMILES | CNC(=C(C#N)C#N)N(Cc1ccsc1)C1CCN([C@H](C)CCNC(=O)c2c(C)cc(C)nc2Cl)CC1 |
| InChI | InChI=1S/C27H34ClN7OS/c1-18-13-19(2)33-25(28)24(18)27(36)32-9-5-20(3)34-10-6-23(7-11-34)35(16-21-8-12-37-17-21)26(31-4)22(14-29)15-30/h8,12-13,17,20,23,31H,5-7,9-11,16H2,1-4H3,(H,32,36)/t20-/m1/s1 |
| InChIKey | HESGAXNMGOFTQT-HXUWFJFHSA-N |
| XLogP | 4.37 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|