C30H41ClN6O3S — CID 143378793
6-chloro-N-[3-[4-[[(2E)-2-[(Z)-2-(hydroxyamino)ethenyl]penta-2,4-dienyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 143378793) has the molecular formula C30H41ClN6O3S and a molecular weight of 601.22 g/mol. Its IUPAC name is 6-chloro-N-[3-[4-[[(2E)-2-[(Z)-2-(hydroxyamino)ethenyl]penta-2,4-dienyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[3-[4-[[(2E)-2-[(Z)-2-(hydroxyamino)ethenyl]penta-2,4-dienyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 143378793 |
| Molecular Formula | C30H41ClN6O3S |
| Molecular Weight | 601.22 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 6-chloro-N-[3-[4-[[(2E)-2-[(Z)-2-(hydroxyamino)ethenyl]penta-2,4-dienyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | C=C/C=C(\C=C/NO)CNC(=O)N(Cc1ccsc1)C1CCN(C(C)CCNC(=O)c2c(C)cc(Cl)nc2C)CC1 |
| InChI | InChI=1S/C30H41ClN6O3S/c1-5-6-24(8-13-34-40)18-33-30(39)37(19-25-11-16-41-20-25)26-9-14-36(15-10-26)22(3)7-12-32-29(38)28-21(2)17-27(31)35-23(28)4/h5-6,8,11,13,16-17,20,22,26,34,40H,1,7,9-10,12,14-15,18-19H2,2-4H3,(H,32,38)(H,33,39)/b13-8-,24-6+ |
| InChIKey | IXQXGNLVKGXGBZ-AWYDJKGWSA-N |
| XLogP | 5.20 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.22 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|