C60H72N6O5 — CID 44512730
1-(5-amino-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)-3-[2-[2-[(5-amino-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)carbamoylamino]phenoxy]phenyl]urea (PubChem CID 44512730) has the molecular formula C60H72N6O5 and a molecular weight of 957.27 g/mol. Its IUPAC name is 1-(5-amino-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)-3-[2-[2-[(5-amino-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)carbamoylamino]phenoxy]phenyl]urea.
| Compound Name | 1-(5-amino-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)-3-[2-[2-[(5-amino-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)carbamoylamino]phenoxy]phenyl]urea |
|---|---|
| PubChem CID | 44512730 |
| Molecular Formula | C60H72N6O5 |
| Molecular Weight | 957.27 g/mol |
| Exact Mass | 956.56 |
| IUPAC Name | 1-(5-amino-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)-3-[2-[2-[(5-amino-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)carbamoylamino]phenoxy]phenyl]urea |
| SMILES | CC(C)(C)c1cc(N)c2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(NC(=O)Nc3ccccc3Oc3ccccc3NC(=O)Nc3cc(C(C)(C)C)cc4c3Oc3c(N)cc(C(C)(C)C)cc3C4(C)C)c1O2 |
| InChI | InChI=1S/C60H72N6O5/c1-55(2,3)33-25-37-49(41(61)29-33)70-51-39(59(37,13)14)27-35(57(7,8)9)31-45(51)65-53(67)63-43-21-17-19-23-47(43)69-48-24-20-18-22-44(48)64-54(68)66-46-32-36(58(10,11)12)28-40-52(46)71-50-38(60(40,15)16)26-34(30-42(50)62)56(4,5)6/h17-32H,61-62H2,1-16H3,(H2,63,65,67)(H2,64,66,68) |
| InChIKey | FEKZCNGZDCSXIS-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.27 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|