C37H44O3P2 — CID 11828114
2,7-ditert-butyl-9,9-dimethyl-4-[methyl(phenyl)phosphoryl]-5-[methyl(phenyl)phosphoryl]xanthene (PubChem CID 11828114) has the molecular formula C37H44O3P2 and a molecular weight of 598.70 g/mol. Its IUPAC name is 2,7-ditert-butyl-9,9-dimethyl-4-[methyl(phenyl)phosphoryl]-5-[methyl(phenyl)phosphoryl]xanthene.
| Compound Name | 2,7-ditert-butyl-9,9-dimethyl-4-[methyl(phenyl)phosphoryl]-5-[methyl(phenyl)phosphoryl]xanthene |
|---|---|
| PubChem CID | 11828114 |
| Molecular Formula | C37H44O3P2 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 2,7-ditert-butyl-9,9-dimethyl-4-[methyl(phenyl)phosphoryl]-5-[methyl(phenyl)phosphoryl]xanthene |
| SMILES | CC(C)(C)c1cc2c(c([P@@](C)(=O)c3ccccc3)c1)Oc1c(cc(C(C)(C)C)cc1[P@](C)(=O)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C37H44O3P2/c1-35(2,3)25-21-29-33(31(23-25)41(9,38)27-17-13-11-14-18-27)40-34-30(37(29,7)8)22-26(36(4,5)6)24-32(34)42(10,39)28-19-15-12-16-20-28/h11-24H,1-10H3/t41-,42+ |
| InChIKey | FCYNFVHDHAUTRQ-ZRKBJOGQSA-N |
| XLogP | 8.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|