C39H32OP2Se2 — CID 66559430
(5-diphenylphosphinoselenoyl-9,9-dimethylxanthen-4-yl)-diphenyl-selanylidene-λ5-phosphane (PubChem CID 66559430) has the molecular formula C39H32OP2Se2 and a molecular weight of 736.55 g/mol. Its IUPAC name is (5-diphenylphosphinoselenoyl-9,9-dimethylxanthen-4-yl)-diphenyl-selanylidene-λ5-phosphane.
| Compound Name | (5-diphenylphosphinoselenoyl-9,9-dimethylxanthen-4-yl)-diphenyl-selanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 66559430 |
| Molecular Formula | C39H32OP2Se2 |
| Molecular Weight | 736.55 g/mol |
| Exact Mass | 738.03 |
| IUPAC Name | (5-diphenylphosphinoselenoyl-9,9-dimethylxanthen-4-yl)-diphenyl-selanylidene-λ5-phosphane |
| SMILES | CC1(C)c2cccc(P(=[Se])(c3ccccc3)c3ccccc3)c2Oc2c1cccc2P(=[Se])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H32OP2Se2/c1-39(2)33-25-15-27-35(41(43,29-17-7-3-8-18-29)30-19-9-4-10-20-30)37(33)40-38-34(39)26-16-28-36(38)42(44,31-21-11-5-12-22-31)32-23-13-6-14-24-32/h3-28H,1-2H3 |
| InChIKey | OEXRZFVYZKRQNN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|