C30H28N4O2 — CID 11691431
5-[(5-amino-9,9-dimethylxanthen-4-yl)diazenyl]-9,9-dimethylxanthen-4-amine (PubChem CID 11691431) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 5-[(5-amino-9,9-dimethylxanthen-4-yl)diazenyl]-9,9-dimethylxanthen-4-amine.
| Compound Name | 5-[(5-amino-9,9-dimethylxanthen-4-yl)diazenyl]-9,9-dimethylxanthen-4-amine |
|---|---|
| PubChem CID | 11691431 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 5-[(5-amino-9,9-dimethylxanthen-4-yl)diazenyl]-9,9-dimethylxanthen-4-amine |
| SMILES | CC1(C)c2cccc(N)c2Oc2c(/N=N/c3cccc4c3Oc3c(N)cccc3C4(C)C)cccc21 |
| InChI | InChI=1S/C30H28N4O2/c1-29(2)17-9-5-13-21(31)25(17)35-27-19(29)11-7-15-23(27)33-34-24-16-8-12-20-28(24)36-26-18(30(20,3)4)10-6-14-22(26)32/h5-16H,31-32H2,1-4H3/b34-33+ |
| InChIKey | IRCLETPFCPYLBT-JEIPZWNWSA-N |
| XLogP | 8.13 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|