C39H34OP2Pd+2 — CID 155935452
(5-diphenylphosphaniumyl-9,9-dimethylxanthen-4-yl)-diphenylphosphanium;palladium (PubChem CID 155935452) has the molecular formula C39H34OP2Pd+2 and a molecular weight of 687.07 g/mol. Its IUPAC name is (5-diphenylphosphaniumyl-9,9-dimethylxanthen-4-yl)-diphenylphosphanium;palladium.
| Compound Name | (5-diphenylphosphaniumyl-9,9-dimethylxanthen-4-yl)-diphenylphosphanium;palladium |
|---|---|
| PubChem CID | 155935452 |
| Molecular Formula | C39H34OP2Pd+2 |
| Molecular Weight | 687.07 g/mol |
| Exact Mass | 686.11 |
| IUPAC Name | (5-diphenylphosphaniumyl-9,9-dimethylxanthen-4-yl)-diphenylphosphanium;palladium |
| SMILES | CC1(C)c2cccc([PH+](c3ccccc3)c3ccccc3)c2Oc2c([PH+](c3ccccc3)c3ccccc3)cccc21.[Pd] |
| InChI | InChI=1S/C39H32OP2.Pd/c1-39(2)33-25-15-27-35(41(29-17-7-3-8-18-29)30-19-9-4-10-20-30)37(33)40-38-34(39)26-16-28-36(38)42(31-21-11-5-12-22-31)32-23-13-6-14-24-32;/h3-28H,1-2H3;/p+2 |
| InChIKey | MVQDWAOYLXFNAA-UHFFFAOYSA-P |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.07 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|