C15H12I2O — CID 10813897
4,5-diiodo-9,9-dimethylxanthene (PubChem CID 10813897) has the molecular formula C15H12I2O and a molecular weight of 462.07 g/mol. Its IUPAC name is 4,5-diiodo-9,9-dimethylxanthene.
| Compound Name | 4,5-diiodo-9,9-dimethylxanthene |
|---|---|
| PubChem CID | 10813897 |
| Molecular Formula | C15H12I2O |
| Molecular Weight | 462.07 g/mol |
| Exact Mass | 461.90 |
| IUPAC Name | 4,5-diiodo-9,9-dimethylxanthene |
| SMILES | CC1(C)c2cccc(I)c2Oc2c(I)cccc21 |
| InChI | InChI=1S/C15H12I2O/c1-15(2)9-5-3-7-11(16)13(9)18-14-10(15)6-4-8-12(14)17/h3-8H,1-2H3 |
| InChIKey | QICZOUIGIXPNFK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.07 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|