C51H52O3P2 — CID 101396272
10-[2,7-ditert-butyl-5-(2,8-dimethylphenoxaphosphinin-10-yl)-9,9-dimethylxanthen-4-yl]-2,8-dimethylphenoxaphosphinine (PubChem CID 101396272) has the molecular formula C51H52O3P2 and a molecular weight of 774.92 g/mol. Its IUPAC name is 10-[2,7-ditert-butyl-5-(2,8-dimethylphenoxaphosphinin-10-yl)-9,9-dimethylxanthen-4-yl]-2,8-dimethylphenoxaphosphinine.
| Compound Name | 10-[2,7-ditert-butyl-5-(2,8-dimethylphenoxaphosphinin-10-yl)-9,9-dimethylxanthen-4-yl]-2,8-dimethylphenoxaphosphinine |
|---|---|
| PubChem CID | 101396272 |
| Molecular Formula | C51H52O3P2 |
| Molecular Weight | 774.92 g/mol |
| Exact Mass | 774.34 |
| IUPAC Name | 10-[2,7-ditert-butyl-5-(2,8-dimethylphenoxaphosphinin-10-yl)-9,9-dimethylxanthen-4-yl]-2,8-dimethylphenoxaphosphinine |
| SMILES | Cc1ccc2c(c1)P(c1cc(C(C)(C)C)cc3c1Oc1c(P4c5cc(C)ccc5Oc5ccc(C)cc54)cc(C(C)(C)C)cc1C3(C)C)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C51H52O3P2/c1-29-13-17-37-41(21-29)55(42-22-30(2)14-18-38(42)52-37)45-27-33(49(5,6)7)25-35-47(45)54-48-36(51(35,11)12)26-34(50(8,9)10)28-46(48)56-43-23-31(3)15-19-39(43)53-40-20-16-32(4)24-44(40)56/h13-28H,1-12H3 |
| InChIKey | SXJLGJOVVOVRSU-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.92 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|