C19H17OP — CID 102041839
10-cyclopenta-2,4-dien-1-yl-2,8-dimethylphenoxaphosphinine (PubChem CID 102041839) has the molecular formula C19H17OP and a molecular weight of 292.32 g/mol. Its IUPAC name is 10-cyclopenta-2,4-dien-1-yl-2,8-dimethylphenoxaphosphinine.
| Compound Name | 10-cyclopenta-2,4-dien-1-yl-2,8-dimethylphenoxaphosphinine |
|---|---|
| PubChem CID | 102041839 |
| Molecular Formula | C19H17OP |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 10-cyclopenta-2,4-dien-1-yl-2,8-dimethylphenoxaphosphinine |
| SMILES | Cc1ccc2c(c1)P(C1C=CC=C1)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C19H17OP/c1-13-7-9-16-18(11-13)21(15-5-3-4-6-15)19-12-14(2)8-10-17(19)20-16/h3-12,15H,1-2H3 |
| InChIKey | FATXBTKGJUJEDG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|